TRPV1 activator-1 structure
|
Common Name | TRPV1 activator-1 | ||
|---|---|---|---|---|
| CAS Number | 1803181-80-7 | Molecular Weight | 321.48 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H27NO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of TRPV1 activator-1TRPV1 activator-1 (compound 8), a capsaicin analog, has an altered neck structure. TRPV1 activator-1 interacts specifically with T551 residue[1]. |
| Name | TRPV1 activator-1 |
|---|
| Description | TRPV1 activator-1 (compound 8), a capsaicin analog, has an altered neck structure. TRPV1 activator-1 interacts specifically with T551 residue[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C18H27NO2S |
|---|---|
| Molecular Weight | 321.48 |
| InChIKey | GSYUZLOIFZTYCB-SOFGYWHQSA-N |
| SMILES | COc1cc(CNC(=S)CCCCC=CC(C)C)ccc1O |