4-[ethoxy-(4-methylphenyl)phosphinothioyl]oxybenzonitrile structure
|
Common Name | 4-[ethoxy-(4-methylphenyl)phosphinothioyl]oxybenzonitrile | ||
|---|---|---|---|---|
| CAS Number | 17963-69-8 | Molecular Weight | 317.34300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H16NO2PS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-[ethoxy-(4-methylphenyl)phosphinothioyl]oxybenzonitrile |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H16NO2PS |
|---|---|
| Molecular Weight | 317.34300 |
| Exact Mass | 317.06400 |
| PSA | 84.15000 |
| LogP | 4.56758 |
| Vapour Pressure | 9.46E-08mmHg at 25°C |
| InChIKey | XFKKPERTAQYQGY-UHFFFAOYSA-N |
| SMILES | CCOP(=S)(Oc1ccc(C#N)cc1)c1ccc(C)cc1 |
| p-Tolylphosphonothioic acid O-ethyl ester O-ester with p-hydroxybenzonitrile |
| Phosphonothioic acid,p-tolyl-,O-ethyl ester,O-ester with p-hydroxybenzonitrile |