Lafutidine-d10 structure
|
Common Name | Lafutidine-d10 | ||
|---|---|---|---|---|
| CAS Number | 1795136-26-3 | Molecular Weight | 441.61 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H19D10N3O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Lafutidine-d10Lafutidine-d10 is deuterium labeled Lafutidine. Lafutidine (FRG-8813) is a histamine H2-receptor antagonist (H2RA), with proven gastric mucosal protective effects. Lafutidine can be used for the research of gastroesophageal reflux disease[1]. |
| Name | Lafutidine-d10 |
|---|
| Description | Lafutidine-d10 is deuterium labeled Lafutidine. Lafutidine (FRG-8813) is a histamine H2-receptor antagonist (H2RA), with proven gastric mucosal protective effects. Lafutidine can be used for the research of gastroesophageal reflux disease[1]. |
|---|---|
| Related Catalog | |
| In Vitro | Stable heavy isotopes of hydrogen, carbon, and other elements have been incorporated into drug molecules, largely as tracers for quantitation during the drug development process. Deuteration has gained attention because of its potential to affect the pharmacokinetic and metabolic profiles of drugs[1]. |
| References |
| Molecular Formula | C22H19D10N3O4S |
|---|---|
| Molecular Weight | 441.61 |
| InChIKey | KMZQAVXSMUKBPD-QKXIEJTGSA-N |
| SMILES | O=C(CS(=O)Cc1ccco1)NCC=CCOc1cc(CN2CCCCC2)ccn1 |