4,5-dichloro-2-[(4-chlorophenyl)methyl]pyridazin-3-one structure
|
Common Name | 4,5-dichloro-2-[(4-chlorophenyl)methyl]pyridazin-3-one | ||
|---|---|---|---|---|
| CAS Number | 173843-85-1 | Molecular Weight | 289.54500 | |
| Density | 1.49g/cm3 | Boiling Point | 367.2ºC at 760 mmHg | |
| Molecular Formula | C11H7Cl3N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 175.9ºC | |
| Name | 4,5-dichloro-2-[(4-chlorophenyl)methyl]pyridazin-3-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.49g/cm3 |
|---|---|
| Boiling Point | 367.2ºC at 760 mmHg |
| Molecular Formula | C11H7Cl3N2O |
| Molecular Weight | 289.54500 |
| Flash Point | 175.9ºC |
| Exact Mass | 287.96200 |
| PSA | 34.89000 |
| LogP | 3.25180 |
| Vapour Pressure | 1.39E-05mmHg at 25°C |
| Index of Refraction | 1.641 |
| InChIKey | XSOGOLSMPSVKOL-UHFFFAOYSA-N |
| SMILES | O=c1c(Cl)c(Cl)cnn1Cc1ccc(Cl)cc1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4,5-dichloro-2-(4-chlorobenzyl)-2,3-dihydropyridazin-3-one |