(S)-(+)-imperanene structure
|
Common Name | (S)-(+)-imperanene | ||
|---|---|---|---|---|
| CAS Number | 163634-08-0 | Molecular Weight | 330.37 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H22O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of (S)-(+)-imperanene(S)-(+)-Imperanene can be isolated from Imperata cylindrica. Imperata cylindrica has diuretic and antiinflammatory activity[1]. |
| Name | (S)-(+)-imperanene |
|---|---|
| Synonym | More Synonyms |
| Description | (S)-(+)-Imperanene can be isolated from Imperata cylindrica. Imperata cylindrica has diuretic and antiinflammatory activity[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C19H22O5 |
|---|---|
| Molecular Weight | 330.37 |
| Exact Mass | 330.14700 |
| PSA | 79.15000 |
| LogP | 2.97940 |
| InChIKey | RCQPYMXHGRTMOZ-NHZBNJEXSA-N |
| SMILES | COc1cc(C=CC(CO)Cc2ccc(O)c(OC)c2)ccc1O |
| (+)-imperanene |
| imperanene |
| (S)-imperanene |