2-[(2-hydroxy-3-methoxy-5-methylphenyl)methyl]-6-methoxy-4-methylphenol structure
|
Common Name | 2-[(2-hydroxy-3-methoxy-5-methylphenyl)methyl]-6-methoxy-4-methylphenol | ||
|---|---|---|---|---|
| CAS Number | 1620-70-8 | Molecular Weight | 288.33800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H20O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-[(2-hydroxy-3-methoxy-5-methylphenyl)methyl]-6-methoxy-4-methylphenol |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C17H20O4 |
|---|---|
| Molecular Weight | 288.33800 |
| Exact Mass | 288.13600 |
| PSA | 58.92000 |
| LogP | 3.32260 |
| InChIKey | GOLYEEJKFISPDK-UHFFFAOYSA-N |
| SMILES | COc1cc(C)cc(Cc2cc(C)cc(OC)c2O)c1O |
|
~99%
2-[(2-hydroxy-3... CAS#:1620-70-8 |
| Literature: McKague; Reeve Environmental Science and Technology, 1994 , vol. 28, # 4 p. 573 - 576 |
|
~%
2-[(2-hydroxy-3... CAS#:1620-70-8 |
| Literature: Gierer,J. et al. Acta Chemica Scandinavica, Series B: Organic Chemistry and Biochemistry, 1974 , vol. 28, p. 717 - 729 |
| Phenol,2,2'-methylenebis[6-methoxy-4-methyl |
| 2,2'-(6,6'-Dimethoxy-4,4'-dimethyl)diphenolmethane |
| 6,6'-methylenebis(2-methoxy-4-methylphenol) |
| 3,3'-dihydroxy-4,4'-dimethoxy-6,6'-dimethyl diphenylmethane |
| 2,2'-methylenebis(6-methoxy-4-methylphenol) |
| 2,2'-dihydroxy-3,3'-dimethoxy-5,5'-dimethyl-diphenylmethane |