(2S)-2-benzhydryl-3-methoxy-3-oxo-propanoic acid structure
|
Common Name | (2S)-2-benzhydryl-3-methoxy-3-oxo-propanoic acid | ||
|---|---|---|---|---|
| CAS Number | 161869-03-0 | Molecular Weight | 284.306 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 424.6±33.0 °C at 760 mmHg | |
| Molecular Formula | C17H16O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 153.4±18.9 °C | |
| Name | (2S)-2-benzhydryl-3-methoxy-3-oxo-propanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 424.6±33.0 °C at 760 mmHg |
| Molecular Formula | C17H16O4 |
| Molecular Weight | 284.306 |
| Flash Point | 153.4±18.9 °C |
| Exact Mass | 284.104858 |
| PSA | 63.60000 |
| LogP | 3.62 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.575 |
| InChIKey | MJOIFVQVKWJWTB-HNNXBMFYSA-N |
| SMILES | COC(=O)C(C(=O)O)C(c1ccccc1)c1ccccc1 |
|
~83%
(2S)-2-benzhydr... CAS#:161869-03-0 |
| Literature: AMBRILIA BIOPHARMA INC. Patent: WO2006/114001 A1, 2006 ; Location in patent: Page/Page column 74 ; WO 2006/114001 A1 |
|
~74%
(2S)-2-benzhydr... CAS#:161869-03-0 |
| Literature: Jones, Kristen L.G.; Holloway, M. Katharine; Su, Hua-Poo; Carroll, Steven S.; Burlein, Christine; Touch, Sinoeun; DiStefano, Daniel J.; Sanchez, Rosa I.; Williams, Theresa M.; Vacca, Joseph P.; Coburn, Craig A. Bioorganic and Medicinal Chemistry Letters, 2010 , vol. 20, # 14 p. 4065 - 4068 |
|
~%
(2S)-2-benzhydr... CAS#:161869-03-0 |
| Literature: Chen; Goel Synthetic Communications, 1995 , vol. 25, # 1 p. 49 - 56 |
| Propanedioic acid, 2-(diphenylmethyl)-, monomethyl ester, (2S)- |
| S-Moc-diPhe-OSu |
| methyl 2-(1H-indol-3-yl)ethylcarbamate |
| (2S)-2-methoxycarbonylamino-3,3-diphenylpropanoic acid |
| N'-(Moc)tryptamine |
| methyl N-[2-(3-indolyl)ethyl]carbamate |
| (2S)-2-methoxycarbonylamino-3,3-diphenyl-propionic acid |
| N-methoxycarbonyl-(S)-diphenylalanine |
| N-(methoxycarbonyl)tryptamine |
| [2-(1H-Indol-3-yl)-ethyl]-carbamic acid methyl ester |
| (2S)-2-(Diphenylmethyl)-3-methoxy-3-oxopropanoic acid |
| N-Carbomethoxytryptamine |
| (S)-2-methoxycarbonylamino-3,3-diphenylpropionic acid |