EC1167
Modify Date: 2025-08-26 17:59:41
EC1167 structure
|
Common Name | EC1167 | ||
|---|---|---|---|---|
| CAS Number | 1610414-00-0 | Molecular Weight | 843.81 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C33H45N7O17S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of EC1167EC1167 is the linker for EC1169. EC1169 is prostate-specific membrane antigen targeting-tubulysin conjugate. EC1169 has the potential to treat recurrent metastatic, castration-resistant prostate cancer (MCRPC)[1]. |
| Name | EC1167 |
|---|
| Description | EC1167 is the linker for EC1169. EC1169 is prostate-specific membrane antigen targeting-tubulysin conjugate. EC1169 has the potential to treat recurrent metastatic, castration-resistant prostate cancer (MCRPC)[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C33H45N7O17S |
|---|---|
| Molecular Weight | 843.81 |
| InChIKey | NAFZHTBVPLIASG-YFNVTMOMSA-N |
| SMILES | O=C(O)CCC(NC(=O)NC(CCCCNC(=O)NCc1ccc(CC(=O)NC(CC(=O)O)C(=O)NC(CC(=O)O)C(=O)NC(CS)C(=O)O)cc1)C(=O)O)C(=O)O |