2-(5-nitro-thiazol-2-yl)-3a,4,7,7a-tetrahydro-4,7-methano-isoindole-1,3-dione structure
|
Common Name | 2-(5-nitro-thiazol-2-yl)-3a,4,7,7a-tetrahydro-4,7-methano-isoindole-1,3-dione | ||
|---|---|---|---|---|
| CAS Number | 16060-67-6 | Molecular Weight | 291.28300 | |
| Density | 1.659g/cm3 | Boiling Point | 492.2ºC at 760 mmHg | |
| Molecular Formula | C12H9N3O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 251.5ºC | |
| Name | 2-(5-nitro-thiazol-2-yl)-3a,4,7,7a-tetrahydro-4,7-methano-isoindole-1,3-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.659g/cm3 |
|---|---|
| Boiling Point | 492.2ºC at 760 mmHg |
| Molecular Formula | C12H9N3O4S |
| Molecular Weight | 291.28300 |
| Flash Point | 251.5ºC |
| Exact Mass | 291.03100 |
| PSA | 124.33000 |
| LogP | 1.95100 |
| Vapour Pressure | 7.85E-10mmHg at 25°C |
| Index of Refraction | 1.708 |
| InChIKey | DYDUEZDUGQXVHR-UHFFFAOYSA-N |
| SMILES | O=C1C2C3C=CC(C3)C2C(=O)N1c1ncc([N+](=O)[O-])s1 |
|
~%
2-(5-nitro-thia... CAS#:16060-67-6 |
| Literature: Rice,L.M. et al. Journal of Medicinal Chemistry, 1968 , vol. 11, # 1 p. 183 - 185 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HMS3085D13 |
| 2-(5-nitro-1,3-thiazol-2-yl)-3a,4,7,7a-tetrahydro-1h-4,7-methanoisoindole-1,3(2h)-dione |
| N-(5-Nitro-2-thiazolyl)-bicyclo<2.2.1>hepten-(5)-2,3-dicarbonsaeureimid |