2,6-dianilino-1H-1,3,5-triazine-4-thione structure
|
Common Name | 2,6-dianilino-1H-1,3,5-triazine-4-thione | ||
|---|---|---|---|---|
| CAS Number | 15989-50-1 | Molecular Weight | 295.36200 | |
| Density | 1.33g/cm3 | Boiling Point | 430.8ºC at 760 mmHg | |
| Molecular Formula | C15H13N5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 214.3ºC | |
| Name | 2,6-dianilino-1H-1,3,5-triazine-4-thione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.33g/cm3 |
|---|---|
| Boiling Point | 430.8ºC at 760 mmHg |
| Molecular Formula | C15H13N5S |
| Molecular Weight | 295.36200 |
| Flash Point | 214.3ºC |
| Exact Mass | 295.08900 |
| PSA | 107.99000 |
| LogP | 2.49130 |
| Vapour Pressure | 1.26E-07mmHg at 25°C |
| Index of Refraction | 1.713 |
| InChIKey | ZHVAHDKGUHZVSB-UHFFFAOYSA-N |
| SMILES | S=c1nc(Nc2ccccc2)[nH]c(Nc2ccccc2)n1 |
| HS Code | 2933699090 |
|---|
| HS Code | 2933699090 |
|---|---|
| Summary | 2933699090 other compounds containing an unfused triazine ring (whether or not hydrogenated) in the structure。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:20.0% |
| 4,6-Dianilino-1,3,5-triazine-2(1H)-thione |
| 2,4-Dianilino-1,3,5-triazin-thiol-(6) |
| 2,4-Dianilino-6-mercapto-s-triazine |
| EINECS 240-128-6 |
| 2,4-Bisanilino-6-thiol-s-triazine |
| s-Triazine-2-thiol,4,6-dianilino-(8CI) |
| 4,6-dianilino-1H-[1,3,5]triazine-2-thione |
| 1,3,5-Triazine-2(1H)-thione,4,6-bis(phenylamino) |