5-acetamido-4-hydroxy-2-phenoxy-6-(1,2,3-trihydroxypropyl)oxane-2-carboxylic acid structure
|
Common Name | 5-acetamido-4-hydroxy-2-phenoxy-6-(1,2,3-trihydroxypropyl)oxane-2-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 15964-32-6 | Molecular Weight | 385.36600 | |
| Density | 1.5g/cm3 | Boiling Point | 786.7ºC at 760 mmHg | |
| Molecular Formula | C17H23NO9 | Melting Point | N/A | |
| MSDS | USA | Flash Point | 429.6ºC | |
| Name | 5-acetamido-4-hydroxy-2-phenoxy-6-(1,2,3-trihydroxypropyl)oxane-2-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5g/cm3 |
|---|---|
| Boiling Point | 786.7ºC at 760 mmHg |
| Molecular Formula | C17H23NO9 |
| Molecular Weight | 385.36600 |
| Flash Point | 429.6ºC |
| Exact Mass | 385.13700 |
| PSA | 165.78000 |
| Vapour Pressure | 4.5E-26mmHg at 25°C |
| Index of Refraction | 1.626 |
| InChIKey | FLOVUNWVDMMYKY-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1C(O)CC(Oc2ccccc2)(C(=O)O)OC1C(O)C(O)CO |
| RIDADR | NONH for all modes of transport |
|---|
| 2-O-Phenyl-|A-D-N-acetylneuraminic acid |