4-Chloro-8-(trifluoromethyl)-3-quinolinecarbonitrile structure
|
Common Name | 4-Chloro-8-(trifluoromethyl)-3-quinolinecarbonitrile | ||
|---|---|---|---|---|
| CAS Number | 157301-82-1 | Molecular Weight | 256.61100 | |
| Density | 1.5g/cm3 | Boiling Point | 349.2ºC at 760 mmHg | |
| Molecular Formula | C11H4ClF3N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 165ºC | |
| Name | 4-Chloro-8-(trifluoromethyl)-3-quinolinecarbonitrile |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5g/cm3 |
|---|---|
| Boiling Point | 349.2ºC at 760 mmHg |
| Molecular Formula | C11H4ClF3N2 |
| Molecular Weight | 256.61100 |
| Flash Point | 165ºC |
| Exact Mass | 256.00200 |
| PSA | 36.68000 |
| LogP | 3.77868 |
| Vapour Pressure | 4.78E-05mmHg at 25°C |
| Index of Refraction | 1.578 |
| InChIKey | AECGTVCPQODZIE-UHFFFAOYSA-N |
| SMILES | N#Cc1cnc2c(C(F)(F)F)cccc2c1Cl |
|
~62%
4-Chloro-8-(tri... CAS#:157301-82-1 |
| Literature: Hu, Baihua; Jetter, James; Kaufman, David; Singhaus, Robert; Bernotas, Ronald; Unwalla, Rayomand; Quinet, Elaine; Savio, Dawn; Halpern, Anita; Basso, Michael; Keith, James; Clerin, Valerie; Chen, Liang; Liu, Qiang-Yuan; Feingold, Irene; Huselton, Christine; Azam, Farooq; Goos-Nilsson, Annika; Wilhelmsson, Anna; Nambi, Ponnal; Wrobel, Jay Bioorganic and Medicinal Chemistry, 2007 , vol. 15, # 10 p. 3321 - 3333 |
|
~%
4-Chloro-8-(tri... CAS#:157301-82-1 |
| Literature: Hu, Baihua; Jetter, James; Kaufman, David; Singhaus, Robert; Bernotas, Ronald; Unwalla, Rayomand; Quinet, Elaine; Savio, Dawn; Halpern, Anita; Basso, Michael; Keith, James; Clerin, Valerie; Chen, Liang; Liu, Qiang-Yuan; Feingold, Irene; Huselton, Christine; Azam, Farooq; Goos-Nilsson, Annika; Wilhelmsson, Anna; Nambi, Ponnal; Wrobel, Jay Bioorganic and Medicinal Chemistry, 2007 , vol. 15, # 10 p. 3321 - 3333 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 4-chloro-7-trifluoromethylquinoline N-oxide |