ethoxy-hydroxy-(4-nitrophenoxy)-sulfanylidene-λ5-phosphane structure
|
Common Name | ethoxy-hydroxy-(4-nitrophenoxy)-sulfanylidene-λ5-phosphane | ||
|---|---|---|---|---|
| CAS Number | 15576-30-4 | Molecular Weight | 263.20700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H10NO5PS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | ethoxy-hydroxy-(4-nitrophenoxy)-sulfanylidene-λ5-phosphane |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C8H10NO5PS |
|---|---|
| Molecular Weight | 263.20700 |
| Exact Mass | 263.00200 |
| PSA | 126.41000 |
| LogP | 3.40070 |
| InChIKey | XMKHJEUOVFAEHH-UHFFFAOYSA-N |
| SMILES | CCOP(O)(=S)Oc1ccc([N+](=O)[O-])cc1 |
|
~%
ethoxy-hydroxy-... CAS#:15576-30-4 |
| Literature: Catrina, Irina E.; Hengge, Alvan C. Journal of the American Chemical Society, 2003 , vol. 125, # 25 p. 7546 - 7552 |
| Phosphorothioic acid,O-ethyl O-(4-nitrophenyl) ester |
| ethyl [14N]-p-nitrophenyl phosphorothioate |
| O-Ethyl O-(4-nitrophenyl) phosphorothioate |
| Desethyl parathion |
| ethyl p-nitrophenyl phosphorothioate |
| O-Ethyl-O-(4-nitro-phenyl)-thiophosphat |