ethyl 5-[methyl(phenyl)sulfamoyl]-1H-pyrazole-4-carboxylate structure
|
Common Name | ethyl 5-[methyl(phenyl)sulfamoyl]-1H-pyrazole-4-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 155144-44-8 | Molecular Weight | 309.34100 | |
| Density | 1.386g/cm3 | Boiling Point | 526ºC at 760 mmHg | |
| Molecular Formula | C13H15N3O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 271.9ºC | |
| Name | ethyl 5-[methyl(phenyl)sulfamoyl]-1H-pyrazole-4-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.386g/cm3 |
|---|---|
| Boiling Point | 526ºC at 760 mmHg |
| Molecular Formula | C13H15N3O4S |
| Molecular Weight | 309.34100 |
| Flash Point | 271.9ºC |
| Exact Mass | 309.07800 |
| PSA | 100.74000 |
| LogP | 2.49230 |
| Vapour Pressure | 3.71E-11mmHg at 25°C |
| Index of Refraction | 1.599 |
| InChIKey | RDWVJTNHHWOXBA-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1cn[nH]c1S(=O)(=O)N(C)c1ccccc1 |
|
~%
ethyl 5-[methyl... CAS#:155144-44-8 |
| Literature: Diaz; Vega Journal of Heterocyclic Chemistry, 1994 , vol. 31, # 1 p. 93 - 96 |
| Ethyl 3-((methylphenylamino)sulfonyl)-1H-pyrazole-4-carboxylate |
| ethyl 3-(N-phenyl-N-methyl)sulfamoylpyrazole-4-carboxylate |
| F3382-3938 |
| 1H-Pyrazole-4-carboxylic acid,3-((methylphenylamino)sulfonyl)-,ethyl ester |