lithium ricinoleate
Modify Date: 2025-08-30 18:55:03
lithium ricinoleate structure
|
Common Name | lithium ricinoleate | ||
|---|---|---|---|---|
| CAS Number | 15467-06-8 | Molecular Weight | 304.39400 | |
| Density | N/A | Boiling Point | 416.4ºC at 760 mmHg | |
| Molecular Formula | C18H33LiO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 219.8ºC | |
| Name | lithium ricinoleate |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 416.4ºC at 760 mmHg |
|---|---|
| Molecular Formula | C18H33LiO3 |
| Molecular Weight | 304.39400 |
| Flash Point | 219.8ºC |
| Exact Mass | 304.25900 |
| PSA | 60.36000 |
| LogP | 3.74460 |
| Vapour Pressure | 1.12E-08mmHg at 25°C |
| InChIKey | UWZUWNMEIDBHOF-DPMBMXLASA-M |
| SMILES | CCCCCCC(O)CC=CCCCCCCCC(=O)[O-].[Li+] |
| HS Code | 2918199090 |
|---|
| HS Code | 2918199090 |
|---|---|
| Summary | 2918199090 other carboxylic acids with alcohol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| RICINOLEICACID,LITHIUMSALT |
| Ricinoic acid lithium salt |
| Lithiumricinoleat |