1-chloro-4-[2,2,2-trichloro-1-(4-chlorophenyl)-1-fluoroethyl]benzene structure
|
Common Name | 1-chloro-4-[2,2,2-trichloro-1-(4-chlorophenyl)-1-fluoroethyl]benzene | ||
|---|---|---|---|---|
| CAS Number | 1545-65-9 | Molecular Weight | 372.47700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H8Cl5F | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-chloro-4-[2,2,2-trichloro-1-(4-chlorophenyl)-1-fluoroethyl]benzene |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H8Cl5F |
|---|---|
| Molecular Weight | 372.47700 |
| Exact Mass | 369.90500 |
| LogP | 6.57670 |
| InChIKey | GOOOHCXSOGHJJY-UHFFFAOYSA-N |
| SMILES | FC(c1ccc(Cl)cc1)(c1ccc(Cl)cc1)C(Cl)(Cl)Cl |
|
~%
1-chloro-4-[2,2... CAS#:1545-65-9 |
| Literature: Cohen; Kaluszyner; Mechoulam Journal of the American Chemical Society, 1957 , vol. 79, p. 5979,5980 Anm. 13 |
| Benzene,1,1'-(2,2,2-trichloro-1-fluoroethylidene)bis[4-chloro |
| 1,1,1-trichloro-2,2-bis-(4-chloro-phenyl)-2-fluoro-ethane |
| 1,1,1-Trichlor-2,2-bis-(4-chlor-phenyl)-2-fluor-aethan |