1-(3-nitrophenyl)-N-[4-[(3-nitrophenyl)methylideneamino]phenyl]methanimine structure
|
Common Name | 1-(3-nitrophenyl)-N-[4-[(3-nitrophenyl)methylideneamino]phenyl]methanimine | ||
|---|---|---|---|---|
| CAS Number | 15223-32-2 | Molecular Weight | 374.35000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H14N4O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(3-nitrophenyl)-N-[4-[(3-nitrophenyl)methylideneamino]phenyl]methanimine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C20H14N4O4 |
|---|---|
| Molecular Weight | 374.35000 |
| Exact Mass | 374.10200 |
| PSA | 116.36000 |
| LogP | 6.05060 |
| InChIKey | NIGSPDMFTXJDPP-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cccc(C=Nc2ccc(N=Cc3cccc([N+](=O)[O-])c3)cc2)c1 |
|
~%
1-(3-nitropheny... CAS#:15223-32-2 |
| Literature: Jhaumeer-Laulloo; Bhowon, Minu G. Indian Journal of Chemistry - Section A Inorganic, Physical, Theoretical and Analytical Chemistry, 2003 , vol. 42, # 10 p. 2536 - 2540 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| N-[(E)-(3-nitrophenyl)methylidene]-N'-[(Z)-(3-nitrophenyl)methylidene]benzene-1,4-diamine |
| bis(m-nitrobenzaldehyde)-p-phenylenediimine |
| bis-(3-nitro-benzylidene)-p-phenylenediamine |
| Bis-(3-nitro-benzyliden)-p-phenylendiamin |
| 1,4-Benzenediamine,N,N'-bis[(3-nitrophenyl)methylene] |