1-[[5-(4-chlorophenyl)-2-methyl-1-phenylpyrrol-3-yl]methyl]imidazole structure
|
Common Name | 1-[[5-(4-chlorophenyl)-2-methyl-1-phenylpyrrol-3-yl]methyl]imidazole | ||
|---|---|---|---|---|
| CAS Number | 146204-70-8 | Molecular Weight | 347.84100 | |
| Density | 1.19g/cm3 | Boiling Point | 543.5ºC at 760 mmHg | |
| Molecular Formula | C21H18ClN3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 282.5ºC | |
| Name | 1-[[5-(4-chlorophenyl)-2-methyl-1-phenylpyrrol-3-yl]methyl]imidazole |
|---|
| Density | 1.19g/cm3 |
|---|---|
| Boiling Point | 543.5ºC at 760 mmHg |
| Molecular Formula | C21H18ClN3 |
| Molecular Weight | 347.84100 |
| Flash Point | 282.5ºC |
| Exact Mass | 347.11900 |
| PSA | 22.75000 |
| LogP | 5.35090 |
| Vapour Pressure | 2.54E-11mmHg at 25°C |
| Index of Refraction | 1.636 |
| InChIKey | GXIYLETWCJDIFL-UHFFFAOYSA-N |
| SMILES | Cc1c(Cn2ccnc2)cc(-c2ccc(Cl)cc2)n1-c1ccccc1 |
|
~51%
1-[[5-(4-chloro... CAS#:146204-70-8 |
| Literature: Cerreto; Villa; Retico; Scalzo European Journal of Medicinal Chemistry, 1992 , vol. 27, # 7 p. 701 - 708 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |