1-[[5-(4-chlorophenyl)-2-methyl-1-phenylpyrrol-3-yl]methyl]-4-methylpiperazine structure
|
Common Name | 1-[[5-(4-chlorophenyl)-2-methyl-1-phenylpyrrol-3-yl]methyl]-4-methylpiperazine | ||
|---|---|---|---|---|
| CAS Number | 146204-44-6 | Molecular Weight | 379.92600 | |
| Density | 1.15g/cm3 | Boiling Point | 509.3ºC at 760mmHg | |
| Molecular Formula | C23H26ClN3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 261.8ºC | |
| Name | 1-[[5-(4-chlorophenyl)-2-methyl-1-phenylpyrrol-3-yl]methyl]-4-methylpiperazine |
|---|
| Density | 1.15g/cm3 |
|---|---|
| Boiling Point | 509.3ºC at 760mmHg |
| Molecular Formula | C23H26ClN3 |
| Molecular Weight | 379.92600 |
| Flash Point | 261.8ºC |
| Exact Mass | 379.18200 |
| PSA | 11.41000 |
| LogP | 4.72930 |
| Vapour Pressure | 1.71E-10mmHg at 25°C |
| Index of Refraction | 1.613 |
| InChIKey | SOLADHUNVIQDNM-UHFFFAOYSA-N |
| SMILES | Cc1c(CN2CCN(C)CC2)cc(-c2ccc(Cl)cc2)n1-c1ccccc1 |
|
~59%
1-[[5-(4-chloro... CAS#:146204-44-6 |
| Literature: Cerreto; Villa; Retico; Scalzo European Journal of Medicinal Chemistry, 1992 , vol. 27, # 7 p. 701 - 708 |
|
~%
1-[[5-(4-chloro... CAS#:146204-44-6 |
| Literature: Cerreto; Villa; Retico; Scalzo European Journal of Medicinal Chemistry, 1992 , vol. 27, # 7 p. 701 - 708 |
|
~%
1-[[5-(4-chloro... CAS#:146204-44-6 |
| Literature: Biava, Mariangela; Fioravanti, Rossella; Porretta, Giulio Cesare; Deidda, Delia; Maullu, Carlo; Pompei, Raffaello Bioorganic and Medicinal Chemistry Letters, 1999 , vol. 9, # 20 p. 2983 - 2988 |