VH032 analogue-2 structure
|
Common Name | VH032 analogue-2 | ||
|---|---|---|---|---|
| CAS Number | 1448189-66-9 | Molecular Weight | 516.65 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C26H36N4O5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of VH032 analogue-2VH032 analogue-2 is a VH032 (HY-120217) analog that acts as a ligand for VHL, recruiting von Hippel-Lindau (VHL) protein. VH032 analogue-2 will remove the protective group under acidic conditions, and can be directly used for the synthesis of PROTAC molecules. VH032 analogue-2 is a key intermediate for the synthesis of PROTACs based on VHL ligands. |
| Name | VH032 analogue-2 |
|---|
| Description | VH032 analogue-2 is a VH032 (HY-120217) analog that acts as a ligand for VHL, recruiting von Hippel-Lindau (VHL) protein. VH032 analogue-2 will remove the protective group under acidic conditions, and can be directly used for the synthesis of PROTAC molecules. VH032 analogue-2 is a key intermediate for the synthesis of PROTACs based on VHL ligands. |
|---|---|
| Related Catalog |
| Molecular Formula | C26H36N4O5S |
|---|---|
| Molecular Weight | 516.65 |
| InChIKey | IBHOCLAWYSUEFY-HKBOAZHASA-N |
| SMILES | Cc1ncsc1-c1ccc(CNC(=O)C2CC(O)CN2C(=O)C(NC(=O)OC(C)(C)C)C(C)C)cc1 |