N-(3,4-diacetamidonaphthalen-2-yl)acetamide structure
|
Common Name | N-(3,4-diacetamidonaphthalen-2-yl)acetamide | ||
|---|---|---|---|---|
| CAS Number | 144153-03-7 | Molecular Weight | 299.32400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H17N3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-(3,4-diacetamidonaphthalen-2-yl)acetamide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H17N3O3 |
|---|---|
| Molecular Weight | 299.32400 |
| Exact Mass | 299.12700 |
| PSA | 97.77000 |
| LogP | 4.66350 |
| InChIKey | PKBSHDZROJAAKL-UHFFFAOYSA-N |
| SMILES | CC(=O)Nc1cc2ccccc2c(NC(C)=O)c1NC(C)=O |
|
~%
N-(3,4-diacetam... CAS#:144153-03-7 |
| Literature: Mataka, Shuntaro; Ikezaki, Youji; Takahashi, Kazufumi; Tori-i, Akiyoshi; Tashiro, Masashi Bulletin of the Chemical Society of Japan, 1992 , vol. 65, # 8 p. 2221 - 2226 |
|
~%
N-(3,4-diacetam... CAS#:144153-03-7 |
| Literature: Mataka, Shuntaro; Ikezaki, Youji; Takahashi, Kazufumi; Tori-i, Akiyoshi; Tashiro, Masashi Bulletin of the Chemical Society of Japan, 1992 , vol. 65, # 8 p. 2221 - 2226 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| Acetamide,N,N',N''-1,2,3-naphthalenetriyltris |
| N,N',N''-triacetyl-1,2,3-naphthalenetriamine |