2-ethyl-3-(hydroxymethyl)naphthalene-1,4-dione
Modify Date: 2025-09-11 23:17:10
2-ethyl-3-(hydroxymethyl)naphthalene-1,4-dione structure
|
Common Name | 2-ethyl-3-(hydroxymethyl)naphthalene-1,4-dione | ||
|---|---|---|---|---|
| CAS Number | 143887-45-0 | Molecular Weight | 216.23300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H12O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-ethyl-3-(hydroxymethyl)naphthalene-1,4-dione |
|---|
| Molecular Formula | C13H12O3 |
|---|---|
| Molecular Weight | 216.23300 |
| Exact Mass | 216.07900 |
| PSA | 54.37000 |
| LogP | 1.76450 |
| InChIKey | GWVGZQOCFVACEA-UHFFFAOYSA-N |
| SMILES | CCC1=C(CO)C(=O)c2ccccc2C1=O |
|
~%
2-ethyl-3-(hydr... CAS#:143887-45-0 |
| Literature: Balzer, Bonnie L.; Cazanoue, Martine; Finn Journal of the American Chemical Society, 1992 , vol. 114, # 22 p. 8735 - 8736 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |