2-bromo-N-tert-butyl-3,3-dimethylbutanamide structure
|
Common Name | 2-bromo-N-tert-butyl-3,3-dimethylbutanamide | ||
|---|---|---|---|---|
| CAS Number | 14387-96-3 | Molecular Weight | 250.17600 | |
| Density | 1.173g/cm3 | Boiling Point | 310.3ºC at 760mmHg | |
| Molecular Formula | C10H20BrNO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 141.5ºC | |
| Name | 2-bromo-N-tert-butyl-3,3-dimethylbutanamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.173g/cm3 |
|---|---|
| Boiling Point | 310.3ºC at 760mmHg |
| Molecular Formula | C10H20BrNO |
| Molecular Weight | 250.17600 |
| Flash Point | 141.5ºC |
| Exact Mass | 249.07300 |
| PSA | 29.10000 |
| LogP | 3.10160 |
| Vapour Pressure | 0.000604mmHg at 25°C |
| Index of Refraction | 1.471 |
| InChIKey | HFBXIPPQGIROOF-UHFFFAOYSA-N |
| SMILES | CC(C)(C)NC(=O)C(Br)C(C)(C)C |
| HS Code | 2924199090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| HS Code | 2924199090 |
|---|---|
| Summary | 2924199090. other acyclic amides (including acyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2-Brom-3,3-dimethyl-N-(tert.-butyl)-butyramid |
| QC-7834 |