5-chloro-2-nitrobenzenethiol
Modify Date: 2025-08-25 20:49:25
5-chloro-2-nitrobenzenethiol structure
|
Common Name | 5-chloro-2-nitrobenzenethiol | ||
|---|---|---|---|---|
| CAS Number | 14371-79-0 | Molecular Weight | 189.61900 | |
| Density | 1.506g/cm3 | Boiling Point | 297.6ºC at 760mmHg | |
| Molecular Formula | C6H4ClNO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 133.8ºC | |
| Name | 5-chloro-2-nitrobenzenethiol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.506g/cm3 |
|---|---|
| Boiling Point | 297.6ºC at 760mmHg |
| Molecular Formula | C6H4ClNO2S |
| Molecular Weight | 189.61900 |
| Flash Point | 133.8ºC |
| Exact Mass | 188.96500 |
| PSA | 84.62000 |
| LogP | 3.06010 |
| Vapour Pressure | 0.00236mmHg at 25°C |
| Index of Refraction | 1.649 |
| InChIKey | RQEQBGNHQNCKCS-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(Cl)cc1S |
|
~%
5-chloro-2-nitr... CAS#:14371-79-0 |
| Literature: Krapcho; Haydar Journal of Heterocyclic Chemistry, 2001 , vol. 38, # 5 p. 1153 - 1166 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
CAS#:33358-41-7| 2-nitro-5-chlorothiophenol |
| 2-nitro-5-chlorobenzenethiol |
| Benzenethiol,5-chloro-2-nitro |
| 5-CHLORO-2-NITROTHIOPHENOL |