10-oxo-N,10-diphenyldeca-6,8-dien-2-ynamide structure
|
Common Name | 10-oxo-N,10-diphenyldeca-6,8-dien-2-ynamide | ||
|---|---|---|---|---|
| CAS Number | 143372-12-7 | Molecular Weight | 329.39200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H19NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 10-oxo-N,10-diphenyldeca-6,8-dien-2-ynamide |
|---|
| Molecular Formula | C22H19NO2 |
|---|---|
| Molecular Weight | 329.39200 |
| Exact Mass | 329.14200 |
| PSA | 49.66000 |
| LogP | 5.05350 |
| InChIKey | IJBFPVWBHUCDPY-UHFFFAOYSA-N |
| SMILES | O=C(C#CCCC=CC=CC(=O)c1ccccc1)Nc1ccccc1 |
|
~82%
10-oxo-N,10-dip... CAS#:143372-12-7 |
| Literature: Trost, Barry M.; Kazmaier, Uli Journal of the American Chemical Society, 1992 , vol. 114, # 20 p. 7933 - 7935 |