Rabacfosadine succinate structure
|
Common Name | Rabacfosadine succinate | ||
|---|---|---|---|---|
| CAS Number | 1431856-99-3 | Molecular Weight | 644.61400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C25H41N8O10P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Rabacfosadine succinateRabacfosadine (GS-9219) succinate, a novel proagent of the nucleotide analogue PMEG, is designed as a cytotoxic agent that preferentially targets lymphoid cells[1]. |
| Name | butanedioic acid,ethyl (2S)-2-[[2-[2-amino-6-(cyclopropylamino)purin-9-yl]ethoxymethyl-[[(2S)-1-ethoxy-1-oxopropan-2-yl]amino]phosphoryl]amino]propanoate |
|---|---|
| Synonym | More Synonyms |
| Description | Rabacfosadine (GS-9219) succinate, a novel proagent of the nucleotide analogue PMEG, is designed as a cytotoxic agent that preferentially targets lymphoid cells[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C25H41N8O10P |
|---|---|
| Molecular Weight | 644.61400 |
| Exact Mass | 644.26800 |
| PSA | 269.75000 |
| LogP | 1.95310 |
| InChIKey | XLBDQSJWTNREFA-IODNYQNNSA-N |
| SMILES | CCOC(=O)C(C)NP(=O)(COCCn1cnc2c(NC3CC3)nc(N)nc21)NC(C)C(=O)OCC.O=C(O)CCC(=O)O |
| GS-9219 succinate |
| UNII-3L28LG748I |
| L-Alanine,N,N'-(((2-(2-amino-6-(cyclopropylamino)-9H-purin-9-yl)ethoxy)methyl)phosphinylidene)bis-,diethyl ester,succinic acid salt (1:1) |