(4-nitrophenyl) N-[4-(benzenesulfonyl)phenyl]carbamate
Modify Date: 2025-08-25 13:21:52
![(4-nitrophenyl) N-[4-(benzenesulfonyl)phenyl]carbamate Structure](https://image.chemsrc.com/caspic/299/14257-87-5.png)
(4-nitrophenyl) N-[4-(benzenesulfonyl)phenyl]carbamate structure
|
Common Name | (4-nitrophenyl) N-[4-(benzenesulfonyl)phenyl]carbamate | ||
|---|---|---|---|---|
| CAS Number | 14257-87-5 | Molecular Weight | 398.38900 | |
| Density | 1.45g/cm3 | Boiling Point | 592.7ºC at 760 mmHg | |
| Molecular Formula | C19H14N2O6S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 312.3ºC | |
| Name | (4-nitrophenyl) N-[4-(benzenesulfonyl)phenyl]carbamate |
|---|
| Density | 1.45g/cm3 |
|---|---|
| Boiling Point | 592.7ºC at 760 mmHg |
| Molecular Formula | C19H14N2O6S |
| Molecular Weight | 398.38900 |
| Flash Point | 312.3ºC |
| Exact Mass | 398.05700 |
| PSA | 126.67000 |
| LogP | 5.71550 |
| Vapour Pressure | 5.09E-14mmHg at 25°C |
| Index of Refraction | 1.658 |
| InChIKey | JHMUITDUCSMEQY-UHFFFAOYSA-N |
| SMILES | O=C(Nc1ccc(S(=O)(=O)c2ccccc2)cc1)Oc1ccc([N+](=O)[O-])cc1 |
|
~%
(4-nitrophenyl)... CAS#:14257-87-5 |
| Literature: Zheng, Xiaozhang; Bauer, Paul; Baumeister, Timm; Buckmelter, Alexandre J.; Caligiuri, Maureen; Clodfelter, Karl H.; Han, Bingsong; Ho, Yen-Ching; Kley, Nikolai; Lin, Jian; Reynolds, Dominic J.; Sharma, Geeta; Smith, Chase C.; Wang, Zhongguo; Dragovich, Peter S.; Oh, Angela; Wang, Weiru; Zak, Mark; Gunzner-Toste, Janet; Zhao, Guiling; Yuen, Po-Wai; Bair, Kenneth W. Journal of Medicinal Chemistry, 2013 , vol. 56, # 12 p. 4921 - 4937 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |