1,2,4,5-tetramethyl-3,6-bis(4-nitrophenoxy)benzene structure
|
Common Name | 1,2,4,5-tetramethyl-3,6-bis(4-nitrophenoxy)benzene | ||
|---|---|---|---|---|
| CAS Number | 142347-52-2 | Molecular Weight | 408.40400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H20N2O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1,2,4,5-tetramethyl-3,6-bis(4-nitrophenoxy)benzene |
|---|
| Molecular Formula | C22H20N2O6 |
|---|---|
| Molecular Weight | 408.40400 |
| Exact Mass | 408.13200 |
| PSA | 110.10000 |
| LogP | 7.36760 |
| InChIKey | JZTOSTGPPMCYQG-UHFFFAOYSA-N |
| SMILES | Cc1c(C)c(Oc2ccc([N+](=O)[O-])cc2)c(C)c(C)c1Oc1ccc([N+](=O)[O-])cc1 |
|
~44%
1,2,4,5-tetrame... CAS#:142347-52-2 |
| Literature: Barclay, George G.; Candlin, Jack P.; Lawne, William; Pauson, Peter L. Journal of Chemical Research, Miniprint, 1992 , p. 2169 - 2187 |
|
~%
1,2,4,5-tetrame... CAS#:142347-52-2 |
| Literature: Barclay, George G.; Candlin, Jack P.; Lawne, William; Pauson, Peter L. Journal of Chemical Research, Miniprint, 1992 , p. 2169 - 2187 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |