(4-nitrophenyl) N-[4-(4-bromophenyl)sulfonylphenyl]carbamate structure
|
Common Name | (4-nitrophenyl) N-[4-(4-bromophenyl)sulfonylphenyl]carbamate | ||
|---|---|---|---|---|
| CAS Number | 14193-09-0 | Molecular Weight | 477.28500 | |
| Density | 1.641g/cm3 | Boiling Point | 622.3ºC at 760mmHg | |
| Molecular Formula | C19H13BrN2O6S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 330.2ºC | |
| Name | (4-nitrophenyl) N-[4-(4-bromophenyl)sulfonylphenyl]carbamate |
|---|
| Density | 1.641g/cm3 |
|---|---|
| Boiling Point | 622.3ºC at 760mmHg |
| Molecular Formula | C19H13BrN2O6S |
| Molecular Weight | 477.28500 |
| Flash Point | 330.2ºC |
| Exact Mass | 475.96800 |
| PSA | 126.67000 |
| LogP | 6.47800 |
| Vapour Pressure | 2.07E-15mmHg at 25°C |
| Index of Refraction | 1.672 |
| InChIKey | JKDLKAKYDGTWNB-UHFFFAOYSA-N |
| SMILES | O=C(Nc1ccc(S(=O)(=O)c2ccc(Br)cc2)cc1)Oc1ccc([N+](=O)[O-])cc1 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |