N,2,2-Trimethyl-N-[4-(trimethylsilyl)phenyl]propanamide structure
|
Common Name | N,2,2-Trimethyl-N-[4-(trimethylsilyl)phenyl]propanamide | ||
|---|---|---|---|---|
| CAS Number | 1418117-84-6 | Molecular Weight | 263.45100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H25NOSi | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N,2,2-Trimethyl-N-[4-(trimethylsilyl)phenyl]propanamide |
|---|
| Molecular Formula | C15H25NOSi |
|---|---|
| Molecular Weight | 263.45100 |
| Exact Mass | 263.17100 |
| PSA | 20.31000 |
| LogP | 3.24070 |
| InChIKey | LINFIEUSGNYJJD-UHFFFAOYSA-N |
| SMILES | CN(C(=O)C(C)(C)C)c1ccc([Si](C)(C)C)cc1 |
|
~58%
N,2,2-Trimethyl... CAS#:1418117-84-6 |
| Literature: Tobisu, Mamoru; Kita, Yusuke; Ano, Yusuke; Chatani, Naoto Journal of the American Chemical Society, 2008 , vol. 130, # 47 p. 15982 - 15989 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |