(2,5-dioxopyrrolidin-1-yl) 3-benzoylbenzoate structure
|
Common Name | (2,5-dioxopyrrolidin-1-yl) 3-benzoylbenzoate | ||
|---|---|---|---|---|
| CAS Number | 141171-86-0 | Molecular Weight | 323.30000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H13NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (2,5-dioxopyrrolidin-1-yl) 3-benzoylbenzoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C18H13NO5 |
|---|---|
| Molecular Weight | 323.30000 |
| Exact Mass | 323.07900 |
| PSA | 80.75000 |
| LogP | 2.07630 |
| InChIKey | FJRRKZUFNMIMRT-UHFFFAOYSA-N |
| SMILES | O=C(ON1C(=O)CCC1=O)c1cccc(C(=O)c2ccccc2)c1 |
|
~95%
(2,5-dioxopyrro... CAS#:141171-86-0 |
| Literature: Kottani, Rudresha; Majjigapu, Janaki R. R.; Kurchan, Alexei; Majjigapu, Kavitha; Gustafson, Tiffany P.; Kutateladze, Andrei G. Journal of the American Chemical Society, 2006 , vol. 128, # 46 p. 14794 - 14795 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 3-benzoylbenzoic acid N-hydroxysuccinimidyl ester |
| 2,5-Pyrrolidinedione,1-[(3-benzoylbenzoyl)oxy] |
| 3-benzoylbenzoic acid succinamide ester |