4-[2,4-bis(2-methylbutan-2-yl)phenoxy]benzene-1,2-dicarbonitrile structure
|
Common Name | 4-[2,4-bis(2-methylbutan-2-yl)phenoxy]benzene-1,2-dicarbonitrile | ||
|---|---|---|---|---|
| CAS Number | 141031-59-6 | Molecular Weight | 360.49200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C24H28N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-[2,4-bis(2-methylbutan-2-yl)phenoxy]benzene-1,2-dicarbonitrile |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C24H28N2O |
|---|---|
| Molecular Weight | 360.49200 |
| Exact Mass | 360.22000 |
| PSA | 56.81000 |
| LogP | 6.59746 |
| InChIKey | HBFQHYLBILFGLA-UHFFFAOYSA-N |
| SMILES | CCC(C)(C)c1ccc(Oc2ccc(C#N)c(C#N)c2)c(C(C)(C)CC)c1 |
|
~82%
4-[2,4-bis(2-me... CAS#:141031-59-6 |
| Literature: Dyes and Pigments, , vol. 92, # 3 p. 942 - 948 |
|
~%
4-[2,4-bis(2-me... CAS#:141031-59-6 |
| Literature: Journal of the Chemical Society, Chemical Communications, , # 12 p. 873 - 875 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 1,2-Benzenedicarbonitrile,4-[2,4-bis(1,1-dimethylpropyl)phenoxy] |
| 4-(2,4-bis(1,1-dimethylpropyl)phenoxy)phthalonitrile |