N-[3-[2-[2-[3-[(2,4-dihydroxy-3,3-dimethylbutanoyl)amino]propanoylamino]ethyldisulfanyl]ethylamino]-3-oxopropyl]-2,4-dihydroxy-3,3-dimethylbutanamide
Modify Date: 2025-09-06 12:18:30
![N-[3-[2-[2-[3-[(2,4-dihydroxy-3,3-dimethylbutanoyl)amino]propanoylamino]ethyldisulfanyl]ethylamino]-3-oxopropyl]-2,4-dihydroxy-3,3-dimethylbutanamide Structure](https://image.chemsrc.com/caspic/114/138148-35-3.png)
N-[3-[2-[2-[3-[(2,4-dihydroxy-3,3-dimethylbutanoyl)amino]propanoylamino]ethyldisulfanyl]ethylamino]-3-oxopropyl]-2,4-dihydroxy-3,3-dimethylbutanamide structure
|
Common Name | N-[3-[2-[2-[3-[(2,4-dihydroxy-3,3-dimethylbutanoyl)amino]propanoylamino]ethyldisulfanyl]ethylamino]-3-oxopropyl]-2,4-dihydroxy-3,3-dimethylbutanamide | ||
|---|---|---|---|---|
| CAS Number | 138148-35-3 | Molecular Weight | 554.72100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H42N4O8S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-[3-[2-[2-[3-[(2,4-dihydroxy-3,3-dimethylbutanoyl)amino]propanoylamino]ethyldisulfanyl]ethylamino]-3-oxopropyl]-2,4-dihydroxy-3,3-dimethylbutanamide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C22H42N4O8S2 |
|---|---|
| Molecular Weight | 554.72100 |
| Exact Mass | 554.24400 |
| PSA | 261.88000 |
| LogP | 1.73280 |
| InChIKey | DJWYOLJPSHDSAL-UHFFFAOYSA-N |
| SMILES | CC(C)(CO)C(O)C(=O)NCCC(=O)NCCSSCCNC(=O)CCNC(=O)C(O)C(C)(C)CO |
|
~%
N-[3-[2-[2-[3-[... CAS#:138148-35-3 |
| Literature: Wittle et al. Journal of the American Chemical Society, 1953 , vol. 75, p. 1694,1698 |
|
~%
N-[3-[2-[2-[3-[... CAS#:138148-35-3 |
| Literature: Hashimoto,M.; Mukaiyama,T. Chemistry Letters, 1972 , p. 595 - 598 |
|
~%
N-[3-[2-[2-[3-[... CAS#:138148-35-3 |
| Literature: Viscontini et al. Helvetica Chimica Acta, 1954 , vol. 37, p. 375 |
![N,N'-(dithiodi-2,1-ethanediyl)bis[1,3-dihydro-1,3-dioxo-2H-isoindole-2-propionamide] structure](https://image.chemsrc.com/caspic/412/87503-54-6.png)
| Bis-(2-D-pantothenoylamino-aethyl)-disulfid |
| Bis-pantethine |
| pantethine |
| bis(pantothenylamidoethyl) disulfide |
| disulfide pantethine |
| Pantethine (JP16) |
| Co-enzyme pantethine |
| Pantosin (TN) |
| Butanamide,N,N'-[dithiobis[2,1-ethanediylimino(3-oxo-3,1-propanediyl)]]bis[2,4-dihydroxy-3,3-dimethyl |
| bis-(2-D-pantothenoylamino-ethyl)-disulfide |