(6aR,9R)-N,N-diethyl-7-(trideuteriomethyl)-6,6a,8,9-tetrahydro-4H-indolo[4,3-fg]quinoline-9-carboxamide structure
|
Common Name | (6aR,9R)-N,N-diethyl-7-(trideuteriomethyl)-6,6a,8,9-tetrahydro-4H-indolo[4,3-fg]quinoline-9-carboxamide | ||
|---|---|---|---|---|
| CAS Number | 136765-38-3 | Molecular Weight | 326.45000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H22D3N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 35.6 °F | |
| Symbol |
GHS02, GHS07 |
Signal Word | Danger | |
| Name | (6aR,9R)-N,N-diethyl-7-(trideuteriomethyl)-6,6a,8,9-tetrahydro-4H-indolo[4,3-fg]quinoline-9-carboxamide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C20H22D3N3O |
|---|---|
| Molecular Weight | 326.45000 |
| Exact Mass | 326.21900 |
| PSA | 39.34000 |
| LogP | 2.84390 |
| InChIKey | VAYOSLLFUXYJDT-WABLSUFGSA-N |
| SMILES | CCN(CC)C(=O)C1C=C2c3cccc4[nH]cc(c34)CC2N(C)C1 |
| Symbol |
GHS02, GHS07 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H225-H302 + H332-H319 |
| Precautionary Statements | P210-P305 + P351 + P338 |
| RIDADR | UN 1648 3 / PGII |
| Flash Point(F) | 35.6 °F |
| Flash Point(C) | 2 °C |
|
Posttranslational Regulation of Human DNA Polymerase ι.
J. Biol. Chem. 290 , 27332-44, (2015) Human DNA polymerases (pols) η and ι are Y-family DNA polymerase paralogs that facilitate translesion synthesis past damaged DNA. Both polη and polι can be monoubiquitinated in vivo. Polη has been sho... |
| LSD-d3 |
| Lysergic Acid-d3 Diethylamide |
| d-LSD-d3 |
| Lysergide-d3 |
| Lysergic acid diethylamide-D3 |
| N,N-Diethyllysergamide-d3 |
| Dextrolysergic Acid-d3 Diethylamide |
| Delysid-d3 |