3-Phenyl-1,2,4-triazolo(3',4':2,3)(1,3,4)thiadiazepino(7,6-b)quinoline structure
|
Common Name | 3-Phenyl-1,2,4-triazolo(3',4':2,3)(1,3,4)thiadiazepino(7,6-b)quinoline | ||
|---|---|---|---|---|
| CAS Number | 136633-10-8 | Molecular Weight | 329.37800 | |
| Density | 1.47g/cm3 | Boiling Point | 686.3ºC at 760 mmHg | |
| Molecular Formula | C18H11N5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 368.9ºC | |
| Name | 3-Phenyl-1,2,4-triazolo(3',4':2,3)(1,3,4)thiadiazepino(7,6-b)quinoline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.47g/cm3 |
|---|---|
| Boiling Point | 686.3ºC at 760 mmHg |
| Molecular Formula | C18H11N5S |
| Molecular Weight | 329.37800 |
| Flash Point | 368.9ºC |
| Exact Mass | 329.07400 |
| PSA | 81.26000 |
| LogP | 3.27570 |
| Vapour Pressure | 1.09E-18mmHg at 25°C |
| Index of Refraction | 1.811 |
| InChIKey | MWESSVHRFZYHIY-UHFFFAOYSA-N |
| SMILES | C1=Nn2c(nnc2-c2ccccc2)Sc2nc3ccccc3cc21 |
|
~93%
3-Phenyl-1,2,4-... CAS#:136633-10-8 |
| Literature: Prabhuswamy; Ambekar, Sarvottam Y. Synthetic Communications, 1999 , vol. 29, # 20 p. 3487 - 3497 |
|
~%
3-Phenyl-1,2,4-... CAS#:136633-10-8 |
| Literature: Kalluraya, Balakrishna; Gururaja; Rai, Ganesha Indian Journal of Chemistry - Section B Organic and Medicinal Chemistry, 2003 , vol. 42, # 1 p. 211 - 214 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 3-phenyl-(1:2:4)-triazolo-[3,4-b](1,3,4)thiadiazepino(6,7-3,2)quinoline |
| 1,2,4-Triazolo(3',4':2,3)(1,3,4)thiadiazepino(7,6-b)quinoline,3-phenyl |