4-benzyl-1-(2-methyl-5-phenylphenyl)piperazine-2,6-dione structure
|
Common Name | 4-benzyl-1-(2-methyl-5-phenylphenyl)piperazine-2,6-dione | ||
|---|---|---|---|---|
| CAS Number | 13480-16-5 | Molecular Weight | 370.44400 | |
| Density | 1.212g/cm3 | Boiling Point | 606.4ºC at 760 mmHg | |
| Molecular Formula | C24H22N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 278.7ºC | |
| Name | 4-benzyl-1-(2-methyl-5-phenylphenyl)piperazine-2,6-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.212g/cm3 |
|---|---|
| Boiling Point | 606.4ºC at 760 mmHg |
| Molecular Formula | C24H22N2O2 |
| Molecular Weight | 370.44400 |
| Flash Point | 278.7ºC |
| Exact Mass | 370.16800 |
| PSA | 40.62000 |
| LogP | 4.04030 |
| Vapour Pressure | 1.19E-14mmHg at 25°C |
| Index of Refraction | 1.63 |
| InChIKey | PGRRFEYBIUJZBQ-UHFFFAOYSA-N |
| SMILES | Cc1ccc(-c2ccccc2)cc1N1C(=O)CN(Cc2ccccc2)CC1=O |
| HS Code | 2933599090 |
|---|
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1-<2-Methyl-biphenylyl-(5)>-4-benzyl-2.6-dioxo-piperazin |
| 1-Benzyl-4-(3-phenyl-4-methylphenyl)-3,5-diketopiperazine |
| 2,6-Piperazinedione,4-benzyl-1-(6-methyl-1,1'-biphenyl-3-yl) |
| 4-benzyl-1-(6-methyl-biphenyl-3-yl)-piperazine-2,6-dione |
| 4-Benzyl-1-(6-methyl-1,1'-biphenyl-3-yl)-2,6-piperazinedione |