Benzyl (2S)-2-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)-4-oxobu tanoate structure
|
Common Name | Benzyl (2S)-2-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)-4-oxobu tanoate | ||
|---|---|---|---|---|
| CAS Number | 134676-02-1 | Molecular Weight | 307.34200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H21NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | Benzyl (2S)-2-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)-4-oxobu tanoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H21NO5 |
|---|---|
| Molecular Weight | 307.34200 |
| Exact Mass | 307.14200 |
| PSA | 85.19000 |
| LogP | 2.41650 |
| InChIKey | HCCRSOLUESXFBI-CYBMUJFWSA-N |
| SMILES | CC(C)(C)OC(=O)NC(CC=O)C(=O)OCc1ccccc1 |
|
~83%
Benzyl (2S)-2-(... CAS#:134676-02-1 |
| Literature: Martin-Martinez; De la Figuera; Latorre; Herranz; Garcia-Lopez; Cenarruzabeitia; Del Rio; Gonzalez-Muniz Journal of Medicinal Chemistry, 2000 , vol. 43, # 20 p. 3770 - 3777 |
|
~%
Benzyl (2S)-2-(... CAS#:134676-02-1 |
| Literature: Martin-Martinez; De la Figuera; Latorre; Herranz; Garcia-Lopez; Cenarruzabeitia; Del Rio; Gonzalez-Muniz Journal of Medicinal Chemistry, 2000 , vol. 43, # 20 p. 3770 - 3777 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| ethyl-2-tert-butoxycarbonyloxyamino-4-methyl-thiazole-5-carboxylate |
| 2-tert-butoxycarbonylamino-4-methylthiazole-5-carboxylic acid ethyl ester |
| Boc-D-Asp(H)-OBzl |
| ETHYL-2-(TERT-BUTOXYCARBONYLAMINO)-4-METHYLTHIAZOLE-5-CARBOXYLATE |
| 2-tert-butoxycarbonylamino-4-oxo-butyric acid benzyl ester |
| ethyl 2-[[(tert-butyloxy)carbonyl]amino]-4-methyl-1,3-thiazole-5-carboxylate |