SAENTA structure
|
Common Name | SAENTA | ||
|---|---|---|---|---|
| CAS Number | 130117-76-9 | Molecular Weight | 461.49500 | |
| Density | 1.7g/cm3 | Boiling Point | 793ºC at 760mmHg | |
| Molecular Formula | C19H23N7O5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 433.4ºC | |
| Name | saenta |
|---|---|
| Synonym | More Synonyms |
| Density | 1.7g/cm3 |
|---|---|
| Boiling Point | 793ºC at 760mmHg |
| Molecular Formula | C19H23N7O5S |
| Molecular Weight | 461.49500 |
| Flash Point | 433.4ºC |
| Exact Mass | 461.14800 |
| PSA | 202.46000 |
| LogP | 1.95420 |
| Vapour Pressure | 1.63E-26mmHg at 25°C |
| Index of Refraction | 1.786 |
| InChIKey | OAFPVFZXWPVEBS-NVQRDWNXSA-N |
| SMILES | NCCSCC1OC(n2cnc3c(NCc4ccc([N+](=O)[O-])cc4)ncnc32)C(O)C1O |
|
~%
SAENTA CAS#:130117-76-9 |
| Literature: Journal of Medicinal Chemistry, , vol. 53, # 16 p. 6040 - 6053 |
| 5'-S-(2-Aminoethyl)-N6-[(4-nitrobenzyl)-5'-thioadenosine |
| 5'-S-(2-aminoethyl)-6-N-(4-nitrobenzyl)-5'-thioadenosine |
| 5'-S-(2-AMinoethyl)-N-[(4-nitrophenyl)Methyl]-5'-thio-adenosine |