2,5-bis(methoxycarbonyl)terephthalic acid
Modify Date: 2025-08-25 07:52:41
2,5-bis(methoxycarbonyl)terephthalic acid structure
|
Common Name | 2,5-bis(methoxycarbonyl)terephthalic acid | ||
|---|---|---|---|---|
| CAS Number | 13011-95-5 | Molecular Weight | 282.20300 | |
| Density | 1.483g/cm3 | Boiling Point | 532.8ºC at 760 mmHg | |
| Molecular Formula | C12H10O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 207.5ºC | |
| Name | 2,5-bis(methoxycarbonyl)terephthalic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.483g/cm3 |
|---|---|
| Boiling Point | 532.8ºC at 760 mmHg |
| Molecular Formula | C12H10O8 |
| Molecular Weight | 282.20300 |
| Flash Point | 207.5ºC |
| Exact Mass | 282.03800 |
| PSA | 127.20000 |
| LogP | 0.65620 |
| Vapour Pressure | 3.49E-12mmHg at 25°C |
| Index of Refraction | 1.583 |
| InChIKey | QUNAYECDJMFUKV-UHFFFAOYSA-N |
| SMILES | COC(=O)c1cc(C(=O)O)c(C(=O)OC)cc1C(=O)O |
| HS Code | 2918990090 |
|---|
| Precursor 1 | |
|---|---|
| DownStream 0 | |
CAS#:1036648-87-9| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2,5-Dicarbomethoxy-terephthalsaeure |
| 1,2,4,5-Benzenetetracarboxylicacid,1,4-dimethyl ester |
| Dimethyl pyromellitate |