1,3-dioxo-2-benzofuran-5-carboxylic acid,oxiran-2-ylmethyl 7,7-dimethyloctanoate structure
|
Common Name | 1,3-dioxo-2-benzofuran-5-carboxylic acid,oxiran-2-ylmethyl 7,7-dimethyloctanoate | ||
|---|---|---|---|---|
| CAS Number | 128730-81-4 | Molecular Weight | 420.45300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H28O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1,3-dioxo-2-benzofuran-5-carboxylic acid,oxiran-2-ylmethyl 7,7-dimethyloctanoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C22H28O8 |
|---|---|
| Molecular Weight | 420.45300 |
| Exact Mass | 420.17800 |
| PSA | 119.50000 |
| LogP | 3.62040 |
| InChIKey | KXWKLHZBMJSLKN-UHFFFAOYSA-N |
| SMILES | CC(C)(C)CCCCCC(=O)OCC1CO1.O=C(O)c1ccc2c(c1)C(=O)OC2=O |
| 5-Isobenzofurancarboxylic acid,1,3-dihydro-1,3-dioxo-,polymer with oxiranylmethyl neodecanoate |
| 5-Isobenzofurancarboxylic acid,1,3-dihydro-1,3-dioxo-,polymer with 2-oxiranylmethyl neodecanoate |
| 1,3-Dihydro-1,3-dioxo-5-isobenzofurancarboxylic acid polymer with oxiranylmethyl neodecanoate |