L-366682
Modify Date: 2025-08-25 08:22:39
L-366682 structure
|
Common Name | L-366682 | ||
|---|---|---|---|---|
| CAS Number | 127819-96-9 | Molecular Weight | 755.90600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C40H53N9O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of L-366682L-366682, a cyclic hexapeptide, possesses antagonism of oxytocin[1]. |
| Name | cyclo- |
|---|---|
| Synonym | More Synonyms |
| Description | L-366682, a cyclic hexapeptide, possesses antagonism of oxytocin[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C40H53N9O6 |
|---|---|
| Molecular Weight | 755.90600 |
| Exact Mass | 755.41200 |
| PSA | 192.70000 |
| LogP | 2.74360 |
| InChIKey | WCNGAVKBHXZVJO-UHFFFAOYSA-N |
| SMILES | CCC(C)C1NC(=O)C(Cc2c[nH]c3ccccc23)NC(=O)C2CCCN2C(=O)C(Cc2cnc[nH]2)NC(=O)C2CCCCN2C(=O)C2CCCCN2C1=O |
| L-366,682 |
| cyclo(D-Trp-Ile-D-Pip-Pip-D-His-Pro) |