2-hydroxypropyl 2-methylprop-2-enoate,2-methylprop-2-enoic acid,styrene structure
|
Common Name | 2-hydroxypropyl 2-methylprop-2-enoate,2-methylprop-2-enoic acid,styrene | ||
|---|---|---|---|---|
| CAS Number | 126326-90-7 | Molecular Weight | 334.40700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H26O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-hydroxypropyl 2-methylprop-2-enoate,2-methylprop-2-enoic acid,styrene |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C19H26O5 |
|---|---|
| Molecular Weight | 334.40700 |
| Exact Mass | 334.17800 |
| PSA | 83.83000 |
| LogP | 3.46320 |
| InChIKey | OBENACRUWNHQKS-UHFFFAOYSA-N |
| SMILES | C=C(C)C(=O)O.C=C(C)C(=O)OCC(C)O.C=Cc1ccccc1 |
| 2-Propenoic acid,2-methyl-,polymer with ethenylbenzene and 2-hydroxypropyl 2-methyl-2-propenoate |
| 2-Hydroxypropyl methacrylate,methacrylic acid,styrene resin |