Carbonodithioic acid, mono(anhydrosulfide) with (2,2,2-trifluoro-1-phenylethylidene)carbamothioic acid, O-ethyl ester structure
|
Common Name | Carbonodithioic acid, mono(anhydrosulfide) with (2,2,2-trifluoro-1-phenylethylidene)carbamothioic acid, O-ethyl ester | ||
|---|---|---|---|---|
| CAS Number | 126088-05-9 | Molecular Weight | 321.3 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H10F3NO2S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | Carbonodithioic acid, mono(anhydrosulfide) with (2,2,2-trifluoro-1-phenylethylidene)carbamothioic acid, O-ethyl ester |
|---|
| Molecular Formula | C12H10F3NO2S2 |
|---|---|
| Molecular Weight | 321.3 |
| InChIKey | DVVNYJSQEBNZFV-UHFFFAOYSA-N |
| SMILES | CCOC(=S)SC(=O)N=C(c1ccccc1)C(F)(F)F |