SQ 32602
Modify Date: 2025-11-01 19:42:04
SQ 32602 structure
|
Common Name | SQ 32602 | ||
|---|---|---|---|---|
| CAS Number | 125399-14-6 | Molecular Weight | 621.756 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C32H52N3O7P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of SQ 32602SQ 32602 is a cathepsin E inhibitor. |
| Name | SQ 32602 |
|---|
| Description | SQ 32602 is a cathepsin E inhibitor. |
|---|---|
| References | 1. Bird JE, Waldron TL, Little DK, Asaad MM, Dorso CR, DiDonato G, Norman JA. The effects of novel cathepsin E inhibitors on the big endothelin pressor response in conscious rats. Biochem Biophys Res Commun. 1992 Jan 15;182(1):224-31. PubMed PMID: 1731782. |
| Molecular Formula | C32H52N3O7P |
|---|---|
| Molecular Weight | 621.756 |
| InChIKey | RHDIRUWZDFQKEV-WSBFXQKSSA-N |
| SMILES | COP(=O)(OC)C(O)C(CC1CCCCC1)NC(CC(C)C)C(=O)NC(=O)C(Cc1ccccc1)NC(=O)C1CCCC1 |