4-methyl-2-phenyl-2-(2-phenylethoxy)morpholine,hydrochloride structure
|
Common Name | 4-methyl-2-phenyl-2-(2-phenylethoxy)morpholine,hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 124497-92-3 | Molecular Weight | 333.85200 | |
| Density | N/A | Boiling Point | 412.1ºC at 760 mmHg | |
| Molecular Formula | C19H24ClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 134.7ºC | |
| Name | 4-methyl-2-phenyl-2-(2-phenylethoxy)morpholine,hydrochloride |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 412.1ºC at 760 mmHg |
|---|---|
| Molecular Formula | C19H24ClNO2 |
| Molecular Weight | 333.85200 |
| Flash Point | 134.7ºC |
| Exact Mass | 333.15000 |
| PSA | 21.70000 |
| LogP | 3.80060 |
| Vapour Pressure | 5.32E-07mmHg at 25°C |
| InChIKey | NUQZKZAUROUDCF-UHFFFAOYSA-N |
| SMILES | CN1CCOC(OCCc2ccccc2)(c2ccccc2)C1.Cl |
|
~59%
4-methyl-2-phen... CAS#:124497-92-3 |
| Literature: European Journal of Medicinal Chemistry, , vol. 24, p. 179 - 184 |
|
~%
4-methyl-2-phen... CAS#:124497-92-3 |
| Literature: European Journal of Medicinal Chemistry, , vol. 24, p. 179 - 184 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 4-Methyl-2-phenyl-2-(2-phenylethoxy)morpholine hydrochloride |
| Morpholine,4-methyl-2-phenyl-2-(2-phenylethoxy)-,hydrochloride |
| 4-methyl-2-phenethyloxy-2-phenylmorpholine hydrochloride |