4-[5-(4-carbamimidoyl-2-methoxyphenoxy)pentoxy]-3-methoxybenzenecarboximidamide structure
|
Common Name | 4-[5-(4-carbamimidoyl-2-methoxyphenoxy)pentoxy]-3-methoxybenzenecarboximidamide | ||
|---|---|---|---|---|
| CAS Number | 124076-64-8 | Molecular Weight | 400.47100 | |
| Density | 1.23g/cm3 | Boiling Point | 583.2ºC at 760mmHg | |
| Molecular Formula | C21H28N4O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 306.5ºC | |
| Name | 4-[5-(4-carbamimidoyl-2-methoxyphenoxy)pentoxy]-3-methoxybenzenecarboximidamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.23g/cm3 |
|---|---|
| Boiling Point | 583.2ºC at 760mmHg |
| Molecular Formula | C21H28N4O4 |
| Molecular Weight | 400.47100 |
| Flash Point | 306.5ºC |
| Exact Mass | 400.21100 |
| PSA | 136.66000 |
| LogP | 4.50010 |
| Vapour Pressure | 1.37E-13mmHg at 25°C |
| Index of Refraction | 1.573 |
| InChIKey | TYWWXLGHQBRSIH-UHFFFAOYSA-N |
| SMILES | COc1cc(C(=N)N)ccc1OCCCCCOc1ccc(C(=N)N)cc1OC |
|
~%
4-[5-(4-carbami... CAS#:124076-64-8 |
| Literature: Tidwell; Jones; Geratz; Ohemeng; Cory; Hall Journal of Medicinal Chemistry, 1990 , vol. 33, # 4 p. 1252 - 1257 |
|
~%
4-[5-(4-carbami... CAS#:124076-64-8 |
| Literature: Berg; Newbery Journal of the Chemical Society, 1949 , p. 642,645 |
|
~%
4-[5-(4-carbami... CAS#:124076-64-8 |
| Literature: Tidwell; Jones; Geratz; Ohemeng; Cory; Hall Journal of Medicinal Chemistry, 1990 , vol. 33, # 4 p. 1252 - 1257 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 3,3'-Dimethoxy-4,4'-pentandiyldioxy-bis-benzamidin |
| 3,3'-dimethoxy-4,4'-pentanediyldioxy-bis-benzamidine |
| 1.5-Bis-(2-methoxy-4-carbamimidoyl-phenoxy)-pentan |
| 1,5-bis(3-methoxybenzamidine-4-oxy)pentane |
| 1,5-Di(4-amidino-2-methoxy)pentane |
| 4,4'-(1,5-Pentanediylbis(oxy))bis(3-methoxybenzenecarboximidamide) |