3-Nitro-5-phenylpyridine structure
|
Common Name | 3-Nitro-5-phenylpyridine | ||
|---|---|---|---|---|
| CAS Number | 123792-62-1 | Molecular Weight | 200.19300 | |
| Density | 1.252g/cm3 | Boiling Point | 353.1ºC at 760mmHg | |
| Molecular Formula | C11H8N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 167.3ºC | |
| Name | 3-Nitro-5-phenylpyridine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.252g/cm3 |
|---|---|
| Boiling Point | 353.1ºC at 760mmHg |
| Molecular Formula | C11H8N2O2 |
| Molecular Weight | 200.19300 |
| Flash Point | 167.3ºC |
| Exact Mass | 200.05900 |
| PSA | 58.71000 |
| LogP | 3.18000 |
| Vapour Pressure | 7.49E-05mmHg at 25°C |
| Index of Refraction | 1.611 |
| InChIKey | LXBLPKWPBMJMOW-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cncc(-c2ccccc2)c1 |
|
~6%
3-Nitro-5-pheny... CAS#:123792-62-1 |
| Literature: Journal of the American Chemical Society, , vol. 133, # 41 p. 16338 - 16341 |
|
~27%
3-Nitro-5-pheny... CAS#:123792-62-1 |
| Literature: Tetrahedron, , vol. 45, # 9 p. 2693 - 2702 |
| Pyridine,3-nitro-5-phenyl |