Dorzolamide-d5 structure
|
Common Name | Dorzolamide-d5 | ||
|---|---|---|---|---|
| CAS Number | 1227097-70-2 | Molecular Weight | 329.47100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H11D5N2O4S3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Dorzolamide-d5Dorzolamide-d5 (L671152-d5) is the deuterium labeled Dorzolamide. Dorzolamide (L671152) is a potent carbonic anhydrase II inhibitor, with IC50 values of 0.18 nM and 600 nM for red blood cell CA-II and CA-I respectively. Dorzolamide possesses anti-tumor activity[1][2]. |
| Name | (4S,6S)-4-((ethyl-d5)amino)-6-methyl-5,6-dihydro-4H-thieno[2,3-b]thiopyran-2-sulfonamide 7,7-dioxide |
|---|
| Description | Dorzolamide-d5 (L671152-d5) is the deuterium labeled Dorzolamide. Dorzolamide (L671152) is a potent carbonic anhydrase II inhibitor, with IC50 values of 0.18 nM and 600 nM for red blood cell CA-II and CA-I respectively. Dorzolamide possesses anti-tumor activity[1][2]. |
|---|---|
| Related Catalog | |
| In Vitro | Stable heavy isotopes of hydrogen, carbon, and other elements have been incorporated into drug molecules, largely as tracers for quantitation during the drug development process. Deuteration has gained attention because of its potential to affect the pharmacokinetic and metabolic profiles of drugs[1]. |
| References |
| Molecular Formula | C10H11D5N2O4S3 |
|---|---|
| Molecular Weight | 329.47100 |
| Exact Mass | 329.05900 |
| PSA | 151.33000 |
| LogP | 3.86480 |
| InChIKey | SGTTVZPWMKGBNU-UHFFFAOYSA-N |
| SMILES | CCNC1CC(C)S(=O)(=O)C2SC(S(N)(=O)=O)C=C12 |