(6-bromo-8-methoxy-2-morpholin-4-yl-2H-chromen-3-yl)-phenylmethanone structure
|
Common Name | (6-bromo-8-methoxy-2-morpholin-4-yl-2H-chromen-3-yl)-phenylmethanone | ||
|---|---|---|---|---|
| CAS Number | 122438-08-8 | Molecular Weight | 430.29200 | |
| Density | 1.443g/cm3 | Boiling Point | 553.8ºC at 760mmHg | |
| Molecular Formula | C21H20BrNO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 288.8ºC | |
| Name | (6-bromo-8-methoxy-2-morpholin-4-yl-2H-chromen-3-yl)-phenylmethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.443g/cm3 |
|---|---|
| Boiling Point | 553.8ºC at 760mmHg |
| Molecular Formula | C21H20BrNO4 |
| Molecular Weight | 430.29200 |
| Flash Point | 288.8ºC |
| Exact Mass | 429.05800 |
| PSA | 48.00000 |
| LogP | 3.71260 |
| Vapour Pressure | 2.62E-12mmHg at 25°C |
| Index of Refraction | 1.624 |
| InChIKey | IUPSJWQDBWDSOC-UHFFFAOYSA-N |
| SMILES | COc1cc(Br)cc2c1OC(N1CCOCC1)C(C(=O)c1ccccc1)=C2 |
|
~24%
(6-bromo-8-meth... CAS#:122438-08-8 |
| Literature: Rene; El Cherif; Boschi; Reny-Palasse; Rips European Journal of Medicinal Chemistry, 1988 , vol. 23, # 6 p. 592 - 593 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| (6-Bromo-8-methoxy-2-(4-morpholinyl)-2H-1-benzopyran-3-yl)phenylmethanone |
| Methanone,(6-bromo-8-methoxy-2-(4-morpholinyl)-2H-1-benzopyran-3-yl)phenyl |