5-[(4-pyridin-2-ylpiperazin-1-yl)methyl]-4,5-dihydro-1,3-oxazol-2-amine structure
|
Common Name | 5-[(4-pyridin-2-ylpiperazin-1-yl)methyl]-4,5-dihydro-1,3-oxazol-2-amine | ||
|---|---|---|---|---|
| CAS Number | 120182-07-2 | Molecular Weight | 261.32300 | |
| Density | 1.37g/cm3 | Boiling Point | 438.4ºC at 760mmHg | |
| Molecular Formula | C13H19N5O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 218.9ºC | |
| Name | 5-[(4-pyridin-2-ylpiperazin-1-yl)methyl]-4,5-dihydro-1,3-oxazol-2-amine |
|---|
| Density | 1.37g/cm3 |
|---|---|
| Boiling Point | 438.4ºC at 760mmHg |
| Molecular Formula | C13H19N5O |
| Molecular Weight | 261.32300 |
| Flash Point | 218.9ºC |
| Exact Mass | 261.15900 |
| PSA | 64.48000 |
| LogP | 0.55820 |
| Vapour Pressure | 6.92E-08mmHg at 25°C |
| Index of Refraction | 1.68 |
| InChIKey | FDMZYWCLSJXOCU-UHFFFAOYSA-N |
| SMILES | NC1=NCC(CN2CCN(c3ccccn3)CC2)O1 |
|
~%
5-[(4-pyridin-2... CAS#:120182-07-2 |
| Literature: Bosc; Jarry; Carpy; Panconi; Descas European Journal of Medicinal Chemistry, 1992 , vol. 27, # 5 p. 437 - 442 |
|
~%
5-[(4-pyridin-2... CAS#:120182-07-2 |
| Literature: Bosc; Jarry; Carpy; Panconi; Descas European Journal of Medicinal Chemistry, 1992 , vol. 27, # 5 p. 437 - 442 |
|
~%
5-[(4-pyridin-2... CAS#:120182-07-2 |
| Literature: Bosc; Jarry; Carpy; Panconi; Descas European Journal of Medicinal Chemistry, 1992 , vol. 27, # 5 p. 437 - 442 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |